C25H40ClFN6O6 — CID 86636933
tert-butyl N-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-N-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]carbamate (PubChem CID 86636933) has the molecular formula C25H40ClFN6O6 and a molecular weight of 575.08 g/mol. Its IUPAC name is tert-butyl N-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-N-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-N-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 86636933 |
| Molecular Formula | C25H40ClFN6O6 |
| Molecular Weight | 575.08 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | tert-butyl N-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-N-[2-chloro-6-[(2R)-2,4-dimethylpiperazin-1-yl]-5-fluoropyrimidin-4-yl]carbamate |
| SMILES | C[C@@H]1CN(C)CCN1c1nc(Cl)nc(N(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C25H40ClFN6O6/c1-15-14-30(11)12-13-31(15)17-16(27)18(29-19(26)28-17)32(20(34)37-23(2,3)4)33(21(35)38-24(5,6)7)22(36)39-25(8,9)10/h15H,12-14H2,1-11H3/t15-/m1/s1 |
| InChIKey | UIXRRBSSQBXGLK-OAHLLOKOSA-N |
| XLogP | 5.24 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.08 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|