C16H17FN2O3 — CID 86637682
ethyl 2-(2-aminoethyl)-4-(4-fluorophenyl)-5-formyl-1H-pyrrole-3-carboxylate (PubChem CID 86637682) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is ethyl 2-(2-aminoethyl)-4-(4-fluorophenyl)-5-formyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-(2-aminoethyl)-4-(4-fluorophenyl)-5-formyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 86637682 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 2-(2-aminoethyl)-4-(4-fluorophenyl)-5-formyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CCN)[nH]c(C=O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O3/c1-2-22-16(21)15-12(7-8-18)19-13(9-20)14(15)10-3-5-11(17)6-4-10/h3-6,9,19H,2,7-8,18H2,1H3 |
| InChIKey | KGSLNOADXSGADQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|