C19H21FN2O5 — CID 86639286
tert-butyl N-[[5-(4-fluoro-3-methylphenoxy)-2-nitrophenyl]methyl]carbamate (PubChem CID 86639286) has the molecular formula C19H21FN2O5 and a molecular weight of 376.38 g/mol. Its IUPAC name is tert-butyl N-[[5-(4-fluoro-3-methylphenoxy)-2-nitrophenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(4-fluoro-3-methylphenoxy)-2-nitrophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 86639286 |
| Molecular Formula | C19H21FN2O5 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | tert-butyl N-[[5-(4-fluoro-3-methylphenoxy)-2-nitrophenyl]methyl]carbamate |
| SMILES | Cc1cc(Oc2ccc([N+](=O)[O-])c(CNC(=O)OC(C)(C)C)c2)ccc1F |
| InChI | InChI=1S/C19H21FN2O5/c1-12-9-14(5-7-16(12)20)26-15-6-8-17(22(24)25)13(10-15)11-21-18(23)27-19(2,3)4/h5-10H,11H2,1-4H3,(H,21,23) |
| InChIKey | NTMKRCCDHIHBTK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|