C15H8FO4- — CID 86640863
3-carboxy-2-(4-fluorophenyl)-1-benzofuran-5-olate (PubChem CID 86640863) has the molecular formula C15H8FO4- and a molecular weight of 271.22 g/mol. Its IUPAC name is 3-carboxy-2-(4-fluorophenyl)-1-benzofuran-5-olate.
| Compound Name | 3-carboxy-2-(4-fluorophenyl)-1-benzofuran-5-olate |
|---|---|
| PubChem CID | 86640863 |
| Molecular Formula | C15H8FO4- |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-carboxy-2-(4-fluorophenyl)-1-benzofuran-5-olate |
| SMILES | O=C(O)c1c(-c2ccc(F)cc2)oc2ccc([O-])cc12 |
| InChI | InChI=1S/C15H9FO4/c16-9-3-1-8(2-4-9)14-13(15(18)19)11-7-10(17)5-6-12(11)20-14/h1-7,17H,(H,18,19)/p-1 |
| InChIKey | HZIKQUPQHICAGZ-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |