C23H24ClFN4O4S — CID 86645375
S-methyl N-[[(5S)-3-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 86645375) has the molecular formula C23H24ClFN4O4S and a molecular weight of 506.99 g/mol. Its IUPAC name is S-methyl N-[[(5S)-3-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | S-methyl N-[[(5S)-3-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 86645375 |
| Molecular Formula | C23H24ClFN4O4S |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | S-methyl N-[[(5S)-3-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | CSC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)c4ccc(Cl)cc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H24ClFN4O4S/c1-34-22(31)26-13-18-14-29(23(32)33-18)17-6-7-20(19(25)12-17)27-8-10-28(11-9-27)21(30)15-2-4-16(24)5-3-15/h2-7,12,18H,8-11,13-14H2,1H3,(H,26,31)/t18-/m0/s1 |
| InChIKey | CNIVNXGDHCFDOF-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|