C21H25BrF6N2O3 — CID 86647202
2-bromo-1-[(3R)-4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazin-1-yl]ethanone (PubChem CID 86647202) has the molecular formula C21H25BrF6N2O3 and a molecular weight of 547.33 g/mol. Its IUPAC name is 2-bromo-1-[(3R)-4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazin-1-yl]ethanone.
| Compound Name | 2-bromo-1-[(3R)-4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86647202 |
| Molecular Formula | C21H25BrF6N2O3 |
| Molecular Weight | 547.33 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 2-bromo-1-[(3R)-4-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazin-1-yl]ethanone |
| SMILES | C/C=C\c1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1N1CCN(C(=O)CBr)C[C@H]1C |
| InChI | InChI=1S/C21H25BrF6N2O3/c1-4-5-15-10-16(19(20(23,24)25,21(26,27)28)33-13-32-3)6-7-17(15)30-9-8-29(12-14(30)2)18(31)11-22/h4-7,10,14H,8-9,11-13H2,1-3H3/b5-4-/t14-/m1/s1 |
| InChIKey | YIQZADQWQIFXCM-ZRUQZJFASA-N |
| XLogP | 5.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.33 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|