C18H20F6N2O3 — CID 87544137
(3R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazine-1-carboxylic acid (PubChem CID 87544137) has the molecular formula C18H20F6N2O3 and a molecular weight of 426.36 g/mol. Its IUPAC name is (3R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazine-1-carboxylic acid.
| Compound Name | (3R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87544137 |
| Molecular Formula | C18H20F6N2O3 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (3R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(Z)-prop-1-enyl]phenyl]-3-methylpiperazine-1-carboxylic acid |
| SMILES | C/C=C\c1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1N1CCN(C(=O)O)C[C@H]1C |
| InChI | InChI=1S/C18H20F6N2O3/c1-3-4-12-9-13(16(29,17(19,20)21)18(22,23)24)5-6-14(12)26-8-7-25(15(27)28)10-11(26)2/h3-6,9,11,29H,7-8,10H2,1-2H3,(H,27,28)/b4-3-/t11-/m1/s1 |
| InChIKey | ZQIYFLUDUABLFZ-DLRQAJBASA-N |
| XLogP | 4.22 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|