C14H19FN2O3 — CID 86648859
methyl 3-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-2-fluorobenzoate (PubChem CID 86648859) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is methyl 3-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-2-fluorobenzoate.
| Compound Name | methyl 3-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 86648859 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl 3-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-2-fluorobenzoate |
| SMILES | COC(=O)c1cccc(N2CC[C@H](N)[C@H](OC)C2)c1F |
| InChI | InChI=1S/C14H19FN2O3/c1-19-12-8-17(7-6-10(12)16)11-5-3-4-9(13(11)15)14(18)20-2/h3-5,10,12H,6-8,16H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | DEGUNUCKSUGYLU-CMPLNLGQSA-N |
| XLogP | 1.16 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |