About S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate
S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate (PubChem CID 86650718) has the molecular formula C9H5F2NO2S
and a molecular weight of 229.21 g/mol. Its IUPAC name is S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate.
Molecular Properties
| Compound Name | S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate |
| PubChem CID | 86650718 |
| Molecular Formula | C9H5F2NO2S |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate |
| SMILES | O=C=NSC(=O)C(F)c1ccccc1F |
| InChI | InChI=1S/C9H5F2NO2S/c10-7-4-2-1-3-6(7)8(11)9(14)15-12-5-13/h1-4,8H |
| InChIKey | PGGQHYDNGJVTLQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate?
The IUPAC name of S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate (CID 86650718) is S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate.
What is the SMILES notation for S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate?
The canonical SMILES for S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate is O=C=NSC(=O)C(F)c1ccccc1F.
What is the InChIKey of S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate?
The InChIKey is PGGQHYDNGJVTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2NO2S/c10-7-4-2-1-3-6(7)8(11)9(14)15-12-5-13/h1-4,8H.
What are the key properties of S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate?
S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate has a molecular weight of 229.21 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-isocyanato 2-fluoro-2-(2-fluorophenyl)ethanethioate is sourced from PubChem (CID 86650718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).