C32H38N2O3 — CID 86653294
tert-butyl (4S,5S)-4-[2-[4-(benzhydrylideneamino)phenyl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 86653294) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-[2-[4-(benzhydrylideneamino)phenyl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-[2-[4-(benzhydrylideneamino)phenyl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 86653294 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | tert-butyl (4S,5S)-4-[2-[4-(benzhydrylideneamino)phenyl]ethyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CCc1ccc(N=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H38N2O3/c1-23-28(34(32(5,6)36-23)30(35)37-31(2,3)4)22-19-24-17-20-27(21-18-24)33-29(25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-18,20-21,23,28H,19,22H2,1-6H3/t23-,28-/m0/s1 |
| InChIKey | PEQDGUQHCJSOOR-FIPFOOKPSA-N |
| XLogP | 7.55 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|