C23H30N4O4 — CID 86655968
benzyl N-[(8S,11R)-10-oxo-8-propan-2-yl-6-oxa-1,9,14-triazabicyclo[11.2.1]hexadeca-3,13(16),14-trien-11-yl]carbamate (PubChem CID 86655968) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is benzyl N-[(8S,11R)-10-oxo-8-propan-2-yl-6-oxa-1,9,14-triazabicyclo[11.2.1]hexadeca-3,13(16),14-trien-11-yl]carbamate.
| Compound Name | benzyl N-[(8S,11R)-10-oxo-8-propan-2-yl-6-oxa-1,9,14-triazabicyclo[11.2.1]hexadeca-3,13(16),14-trien-11-yl]carbamate |
|---|---|
| PubChem CID | 86655968 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | benzyl N-[(8S,11R)-10-oxo-8-propan-2-yl-6-oxa-1,9,14-triazabicyclo[11.2.1]hexadeca-3,13(16),14-trien-11-yl]carbamate |
| SMILES | CC(C)[C@H]1COCC=CCn2cnc(c2)C[C@@H](NC(=O)OCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C23H30N4O4/c1-17(2)21-15-30-11-7-6-10-27-13-19(24-16-27)12-20(22(28)25-21)26-23(29)31-14-18-8-4-3-5-9-18/h3-9,13,16-17,20-21H,10-12,14-15H2,1-2H3,(H,25,28)(H,26,29)/t20-,21-/m1/s1 |
| InChIKey | PAKXXKYINRWESR-NHCUHLMSSA-N |
| XLogP | 2.45 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|