C9H9F4NO2 — CID 86656394
5-(2-methylpropyl)-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride (PubChem CID 86656394) has the molecular formula C9H9F4NO2 and a molecular weight of 239.17 g/mol. Its IUPAC name is 5-(2-methylpropyl)-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride.
| Compound Name | 5-(2-methylpropyl)-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride |
|---|---|
| PubChem CID | 86656394 |
| Molecular Formula | C9H9F4NO2 |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-(2-methylpropyl)-4-(trifluoromethyl)-1,2-oxazole-3-carbonyl fluoride |
| SMILES | CC(C)Cc1onc(C(=O)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H9F4NO2/c1-4(2)3-5-6(9(11,12)13)7(8(10)15)14-16-5/h4H,3H2,1-2H3 |
| InChIKey | LYIMJKYJEXAHCE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|