4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride

C9H12FNO2 — CID 58537190

IUPAC4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride
SMILESCc1c(CC(C)C)noc1C(=O)F
InChIInChI=1S/C9H12FNO2/c1-5(2)4-7-6(3)8(9(10)12)13-11-7/h5H,4H2,1-3H3
InChIKeyIWEOXMJIYDKZMQ-UHFFFAOYSA-N
MW185.20 g/mol
LogP2.29
Rot. Bonds3

About 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride

4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride (PubChem CID 58537190) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride.

Molecular Properties

Compound Name4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride
PubChem CID58537190
Molecular FormulaC9H12FNO2
Molecular Weight185.20 g/mol
Exact Mass185.09
IUPAC Name4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride
SMILESCc1c(CC(C)C)noc1C(=O)F
InChIInChI=1S/C9H12FNO2/c1-5(2)4-7-6(3)8(9(10)12)13-11-7/h5H,4H2,1-3H3
InChIKeyIWEOXMJIYDKZMQ-UHFFFAOYSA-N
XLogP2.29
TPSA43.10 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.20
LogP ≤ 52.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride?
The IUPAC name of 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride (CID 58537190) is 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride.
What is the SMILES notation for 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride?
The canonical SMILES for 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride is Cc1c(CC(C)C)noc1C(=O)F.
What is the InChIKey of 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride?
The InChIKey is IWEOXMJIYDKZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNO2/c1-5(2)4-7-6(3)8(9(10)12)13-11-7/h5H,4H2,1-3H3.
What are the key properties of 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride?
4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride has a molecular weight of 185.20 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride is sourced from PubChem (CID 58537190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).