C9H12FNO2 — CID 58537190
4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride (PubChem CID 58537190) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride.
| Compound Name | 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride |
|---|---|
| PubChem CID | 58537190 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 4-methyl-3-(2-methylpropyl)-1,2-oxazole-5-carbonyl fluoride |
| SMILES | Cc1c(CC(C)C)noc1C(=O)F |
| InChI | InChI=1S/C9H12FNO2/c1-5(2)4-7-6(3)8(9(10)12)13-11-7/h5H,4H2,1-3H3 |
| InChIKey | IWEOXMJIYDKZMQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|