About O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride
O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride (PubChem CID 86657586) has the molecular formula C11H16ClN3OS
and a molecular weight of 273.79 g/mol. Its IUPAC name is O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride.
Molecular Properties
| Compound Name | O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride |
| PubChem CID | 86657586 |
| Molecular Formula | C11H16ClN3OS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride |
| SMILES | Cl.NNC1(NC(=S)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C11H15N3OS.ClH/c12-14-11(6-7-11)13-10(16)15-8-9-4-2-1-3-5-9;/h1-5,14H,6-8,12H2,(H,13,16);1H |
| InChIKey | SYGPHRZCWWBKAW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride?
The IUPAC name of O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride (CID 86657586) is O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride.
What is the SMILES notation for O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride?
The canonical SMILES for O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride is Cl.NNC1(NC(=S)OCc2ccccc2)CC1.
What is the InChIKey of O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride?
The InChIKey is SYGPHRZCWWBKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3OS.ClH/c12-14-11(6-7-11)13-10(16)15-8-9-4-2-1-3-5-9;/h1-5,14H,6-8,12H2,(H,13,16);1H.
What are the key properties of O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride?
O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride has a molecular weight of 273.79 g/mol, XLogP of 1.45, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-benzyl N-(1-hydrazinylcyclopropyl)carbamothioate;hydrochloride is sourced from PubChem (CID 86657586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).