C12H9N2O5S- — CID 86658658
1-(4-methylsulfonylphenyl)-6-oxopyridazine-3-carboxylate (PubChem CID 86658658) has the molecular formula C12H9N2O5S- and a molecular weight of 293.28 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-6-oxopyridazine-3-carboxylate.
| Compound Name | 1-(4-methylsulfonylphenyl)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 86658658 |
| Molecular Formula | C12H9N2O5S- |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-6-oxopyridazine-3-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(=O)[O-])ccc2=O)cc1 |
| InChI | InChI=1S/C12H10N2O5S/c1-20(18,19)9-4-2-8(3-5-9)14-11(15)7-6-10(13-14)12(16)17/h2-7H,1H3,(H,16,17)/p-1 |
| InChIKey | QFXATPBFVQCVFJ-UHFFFAOYSA-M |
| XLogP | -1.00 |
| TPSA | 109.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |