C10H9ClN5O2S- — CID 86658841
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine formate (PubChem CID 86658841) has the molecular formula C10H9ClN5O2S- and a molecular weight of 298.74 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine formate.
| Compound Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine formate |
|---|---|
| PubChem CID | 86658841 |
| Molecular Formula | C10H9ClN5O2S- |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine formate |
| SMILES | Clc1ccc2nsnc2c1NC1=NCCN1.O=C[O-] |
| InChI | InChI=1S/C9H8ClN5S.CH2O2/c10-5-1-2-6-8(15-16-14-6)7(5)13-9-11-3-4-12-9;2-1-3/h1-2H,3-4H2,(H2,11,12,13);1H,(H,2,3)/p-1 |
| InChIKey | CRCSGUWDNUKHAG-UHFFFAOYSA-M |
| XLogP | 0.08 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|