C16H22BrN3O3 — CID 86659946
tert-butyl 1-[[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]azetidine-3-carboxylate (PubChem CID 86659946) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is tert-butyl 1-[[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]azetidine-3-carboxylate.
| Compound Name | tert-butyl 1-[[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 86659946 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | tert-butyl 1-[[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl]azetidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CN(Cc2ccc(/C(N)=N\O)cc2Br)C1 |
| InChI | InChI=1S/C16H22BrN3O3/c1-16(2,3)23-15(21)12-8-20(9-12)7-11-5-4-10(6-13(11)17)14(18)19-22/h4-6,12,22H,7-9H2,1-3H3,(H2,18,19) |
| InChIKey | IHVOIQMUMUHLDA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|