C23H30BN5O3S — CID 86662831
4-[[4-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]amino]pyrimidin-2-yl]amino]cyclohexan-1-ol (PubChem CID 86662831) has the molecular formula C23H30BN5O3S and a molecular weight of 467.40 g/mol. Its IUPAC name is 4-[[4-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]amino]pyrimidin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[4-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]amino]pyrimidin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 86662831 |
| Molecular Formula | C23H30BN5O3S |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-[[4-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]amino]pyrimidin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CC1(C)OB(c2ccc3nc(Nc4ccnc(NC5CCC(O)CC5)n4)sc3c2)OC1(C)C |
| InChI | InChI=1S/C23H30BN5O3S/c1-22(2)23(3,4)32-24(31-22)14-5-10-17-18(13-14)33-21(27-17)29-19-11-12-25-20(28-19)26-15-6-8-16(30)9-7-15/h5,10-13,15-16,30H,6-9H2,1-4H3,(H2,25,26,27,28,29) |
| InChIKey | GTMUYUWOANEMFX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|