C30H33F6N7O4 — CID 86665145
tert-butyl 2-[2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-4-oxo-1-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate (PubChem CID 86665145) has the molecular formula C30H33F6N7O4 and a molecular weight of 669.63 g/mol. Its IUPAC name is tert-butyl 2-[2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-4-oxo-1-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-4-oxo-1-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 86665145 |
| Molecular Formula | C30H33F6N7O4 |
| Molecular Weight | 669.63 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | tert-butyl 2-[2-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)anilino]pyrimidin-4-yl]-4-oxo-1-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate |
| SMILES | CN1CCN(c2ccc(OC(F)(F)F)c(Nc3nccc(-c4cc5c(n4CC(F)(F)F)CCN(C(=O)OC(C)(C)C)C5=O)n3)c2)CC1 |
| InChI | InChI=1S/C30H33F6N7O4/c1-28(2,3)47-27(45)42-10-8-22-19(25(42)44)16-23(43(22)17-29(31,32)33)20-7-9-37-26(38-20)39-21-15-18(41-13-11-40(4)12-14-41)5-6-24(21)46-30(34,35)36/h5-7,9,15-16H,8,10-14,17H2,1-4H3,(H,37,38,39) |
| InChIKey | DHUNLCXTGVJHCM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|