C20H23F3N6O2 — CID 175567930
N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]-4-(1-oxido-3,4-dihydro-2H-pyrrol-1-ium-2-yl)pyrimidin-2-amine (PubChem CID 175567930) has the molecular formula C20H23F3N6O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]-4-(1-oxido-3,4-dihydro-2H-pyrrol-1-ium-2-yl)pyrimidin-2-amine.
| Compound Name | N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]-4-(1-oxido-3,4-dihydro-2H-pyrrol-1-ium-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 175567930 |
| Molecular Formula | C20H23F3N6O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[5-(4-methylpiperazin-1-yl)-2-(trifluoromethoxy)phenyl]-4-(1-oxido-3,4-dihydro-2H-pyrrol-1-ium-2-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(OC(F)(F)F)c(Nc3nccc(C4CCC=[N+]4[O-])n3)c2)CC1 |
| InChI | InChI=1S/C20H23F3N6O2/c1-27-9-11-28(12-10-27)14-4-5-18(31-20(21,22)23)16(13-14)26-19-24-7-6-15(25-19)17-3-2-8-29(17)30/h4-8,13,17H,2-3,9-12H2,1H3,(H,24,25,26) |
| InChIKey | ZIBDAKDFEOJEJN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|