C18H12ClF3N2O2 — CID 86665914
3-chloro-5-(3,5-dimethoxyphenyl)-4-(2,4,6-trifluorophenyl)pyridazine (PubChem CID 86665914) has the molecular formula C18H12ClF3N2O2 and a molecular weight of 380.75 g/mol. Its IUPAC name is 3-chloro-5-(3,5-dimethoxyphenyl)-4-(2,4,6-trifluorophenyl)pyridazine.
| Compound Name | 3-chloro-5-(3,5-dimethoxyphenyl)-4-(2,4,6-trifluorophenyl)pyridazine |
|---|---|
| PubChem CID | 86665914 |
| Molecular Formula | C18H12ClF3N2O2 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 3-chloro-5-(3,5-dimethoxyphenyl)-4-(2,4,6-trifluorophenyl)pyridazine |
| SMILES | COc1cc(OC)cc(-c2cnnc(Cl)c2-c2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C18H12ClF3N2O2/c1-25-11-3-9(4-12(7-11)26-2)13-8-23-24-18(19)16(13)17-14(21)5-10(20)6-15(17)22/h3-8H,1-2H3 |
| InChIKey | KAJOABOVSNXVCU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |