C24H30N3O2S+ — CID 86667059
tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)piperazin-4-ium-1-carboxylate (PubChem CID 86667059) has the molecular formula C24H30N3O2S+ and a molecular weight of 424.59 g/mol. Its IUPAC name is tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)piperazin-4-ium-1-carboxylate.
| Compound Name | tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 86667059 |
| Molecular Formula | C24H30N3O2S+ |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)piperazin-4-ium-1-carboxylate |
| SMILES | CCc1cc(=[N+]2CCN(C(=O)OC(C)(C)C)CC2)cc2sc3cccc(C)c3nc1-2 |
| InChI | InChI=1S/C24H30N3O2S/c1-6-17-14-18(26-10-12-27(13-11-26)23(28)29-24(3,4)5)15-20-22(17)25-21-16(2)8-7-9-19(21)30-20/h7-9,14-15H,6,10-13H2,1-5H3/q+1 |
| InChIKey | YDBMWOYFFAONQC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|