C25H32N3O2S+ — CID 86667049
tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)-1,4-diazepan-4-ium-1-carboxylate (PubChem CID 86667049) has the molecular formula C25H32N3O2S+ and a molecular weight of 438.62 g/mol. Its IUPAC name is tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)-1,4-diazepan-4-ium-1-carboxylate.
| Compound Name | tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)-1,4-diazepan-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 86667049 |
| Molecular Formula | C25H32N3O2S+ |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | tert-butyl 4-(1-ethyl-9-methylphenothiazin-3-ylidene)-1,4-diazepan-4-ium-1-carboxylate |
| SMILES | CCc1c/c(=[N+]2\CCCN(C(=O)OC(C)(C)C)CC2)cc2sc3cccc(C)c3nc1-2 |
| InChI | InChI=1S/C25H32N3O2S/c1-6-18-15-19(16-21-23(18)26-22-17(2)9-7-10-20(22)31-21)27-11-8-12-28(14-13-27)24(29)30-25(3,4)5/h7,9-10,15-16H,6,8,11-14H2,1-5H3/q+1/b27-19- |
| InChIKey | NAJHJSFNUQHCCI-DIBXZPPDSA-N |
| XLogP | 4.68 |
| TPSA | 45.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|