C26H31F3N4O3S — CID 89077287
1-(1-ethyl-9-methyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-amine;2,2,2-trifluoroacetate (PubChem CID 89077287) has the molecular formula C26H31F3N4O3S and a molecular weight of 536.62 g/mol. Its IUPAC name is 1-(1-ethyl-9-methyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-amine;2,2,2-trifluoroacetate.
| Compound Name | 1-(1-ethyl-9-methyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-amine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89077287 |
| Molecular Formula | C26H31F3N4O3S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 1-(1-ethyl-9-methyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-amine;2,2,2-trifluoroacetate |
| SMILES | CCc1cc(=[N+]2CCC(N)CC2)cc2sc3cc(N4CCOCC4)cc(C)c3nc1-2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C24H31N4OS.C2HF3O2/c1-3-17-13-20(27-6-4-18(25)5-7-27)15-22-24(17)26-23-16(2)12-19(14-21(23)30-22)28-8-10-29-11-9-28;3-2(4,5)1(6)7/h12-15,18H,3-11,25H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | DAKAZMYRORNHEI-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|