C37H39F2N5O7 — CID 86667990
tert-butyl 4-[[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-(6-methoxyquinazolin-7-yl)oxymethyl]piperidine-1-carboxylate (PubChem CID 86667990) has the molecular formula C37H39F2N5O7 and a molecular weight of 703.74 g/mol. Its IUPAC name is tert-butyl 4-[[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-(6-methoxyquinazolin-7-yl)oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-(6-methoxyquinazolin-7-yl)oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86667990 |
| Molecular Formula | C37H39F2N5O7 |
| Molecular Weight | 703.74 g/mol |
| Exact Mass | 703.28 |
| IUPAC Name | tert-butyl 4-[[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-(6-methoxyquinazolin-7-yl)oxymethyl]piperidine-1-carboxylate |
| SMILES | COc1cc2cncnc2cc1OC(Oc1ccc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)cc1F)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C37H39F2N5O7/c1-36(2,3)51-35(47)44-15-11-22(12-16-44)32(50-31-19-28-23(17-30(31)48-4)20-40-21-41-28)49-29-10-9-26(18-27(29)39)43-34(46)37(13-14-37)33(45)42-25-7-5-24(38)6-8-25/h5-10,17-22,32H,11-16H2,1-4H3,(H,42,45)(H,43,46) |
| InChIKey | URVGCLMIRKUCED-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 141.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.74 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|