C25H36N2O2S — CID 86668426
(R)-N-[1-[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 86668426) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is (R)-N-[1-[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[1-[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86668426 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | (R)-N-[1-[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(=N[S@](=O)C(C)(C)C)c1ccc2cc(OC3CCC(C(C)(C)C)CC3)ccc2n1 |
| InChI | InChI=1S/C25H36N2O2S/c1-17(27-30(28)25(5,6)7)22-14-8-18-16-21(13-15-23(18)26-22)29-20-11-9-19(10-12-20)24(2,3)4/h8,13-16,19-20H,9-12H2,1-7H3/t19?,20?,30-/m1/s1 |
| InChIKey | NWZIUONRZMISTH-QLNAZMOJSA-N |
| XLogP | 6.49 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|