C21H21BrF6N2O2 — CID 86670933
2-[4-[[4-(4-amino-2-bromophenoxy)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 86670933) has the molecular formula C21H21BrF6N2O2 and a molecular weight of 527.30 g/mol. Its IUPAC name is 2-[4-[[4-(4-amino-2-bromophenoxy)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[[4-(4-amino-2-bromophenoxy)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 86670933 |
| Molecular Formula | C21H21BrF6N2O2 |
| Molecular Weight | 527.30 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 2-[4-[[4-(4-amino-2-bromophenoxy)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc(OC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)c(Br)c1 |
| InChI | InChI=1S/C21H21BrF6N2O2/c22-17-11-15(29)5-6-18(17)32-16-7-9-30(10-8-16)12-13-1-3-14(4-2-13)19(31,20(23,24)25)21(26,27)28/h1-6,11,16,31H,7-10,12,29H2 |
| InChIKey | ALEBVPWPNITESJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|