C18H19FN3OS+ — CID 86672747
1-fluoro-N,N-dimethyl-7-morpholin-4-ium-4-ylidenephenothiazin-3-amine (PubChem CID 86672747) has the molecular formula C18H19FN3OS+ and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-fluoro-N,N-dimethyl-7-morpholin-4-ium-4-ylidenephenothiazin-3-amine.
| Compound Name | 1-fluoro-N,N-dimethyl-7-morpholin-4-ium-4-ylidenephenothiazin-3-amine |
|---|---|
| PubChem CID | 86672747 |
| Molecular Formula | C18H19FN3OS+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-fluoro-N,N-dimethyl-7-morpholin-4-ium-4-ylidenephenothiazin-3-amine |
| SMILES | CN(C)c1cc(F)c2nc3ccc(=[N+]4CCOCC4)cc-3sc2c1 |
| InChI | InChI=1S/C18H19FN3OS/c1-21(2)13-9-14(19)18-17(11-13)24-16-10-12(3-4-15(16)20-18)22-5-7-23-8-6-22/h3-4,9-11H,5-8H2,1-2H3/q+1 |
| InChIKey | HVGCMZDZBSNZND-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 28.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|