About 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide
4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide (PubChem CID 70675791) has the molecular formula C23H29IN4OS
and a molecular weight of 536.48 g/mol. Its IUPAC name is 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide.
Molecular Properties
| Compound Name | 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide |
| PubChem CID | 70675791 |
| Molecular Formula | C23H29IN4OS |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide |
| SMILES | Cc1cc(=[N+]2CCN(C)CC2)cc2sc3cc(N4CCOCC4)cc(C)c3nc1-2.[I-] |
| InChI | InChI=1S/C23H29N4OS.HI/c1-16-12-18(26-6-4-25(3)5-7-26)14-20-22(16)24-23-17(2)13-19(15-21(23)29-20)27-8-10-28-11-9-27;/h12-15H,4-11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GTKPEDINAQCDAB-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 31.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide?
The IUPAC name of 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide (CID 70675791) is 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide.
What is the SMILES notation for 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide?
The canonical SMILES for 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide is Cc1cc(=[N+]2CCN(C)CC2)cc2sc3cc(N4CCOCC4)cc(C)c3nc1-2.[I-].
What is the InChIKey of 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide?
The InChIKey is GTKPEDINAQCDAB-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H29N4OS.HI/c1-16-12-18(26-6-4-25(3)5-7-26)14-20-22(16)24-23-17(2)13-19(15-21(23)29-20)27-8-10-28-11-9-27;/h12-15H,4-11H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide?
4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide has a molecular weight of 536.48 g/mol, XLogP of -0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,9-dimethyl-7-(4-methylpiperazin-1-ium-1-ylidene)phenothiazin-3-yl]morpholine iodide is sourced from PubChem (CID 70675791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).