C20H24ClN4S+ — CID 87411061
1-chloro-N,N-diethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine (PubChem CID 87411061) has the molecular formula C20H24ClN4S+ and a molecular weight of 387.96 g/mol. Its IUPAC name is 1-chloro-N,N-diethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine.
| Compound Name | 1-chloro-N,N-diethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine |
|---|---|
| PubChem CID | 87411061 |
| Molecular Formula | C20H24ClN4S+ |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-chloro-N,N-diethyl-7-piperazin-1-ium-1-ylidenephenothiazin-3-amine |
| SMILES | CCN(CC)c1cc(Cl)c2nc3ccc(=[N+]4CCNCC4)cc-3sc2c1 |
| InChI | InChI=1S/C20H24ClN4S/c1-3-24(4-2)15-11-16(21)20-19(13-15)26-18-12-14(5-6-17(18)23-20)25-9-7-22-8-10-25/h5-6,11-13,22H,3-4,7-10H2,1-2H3/q+1 |
| InChIKey | KQBGAAMTAAUJOH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|