C19H19BrF4N2O3 — CID 86673420
tert-butyl N-[(1R,2R)-1-(5-bromo-2-fluoro-3-pyridinyl)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]carbamate (PubChem CID 86673420) has the molecular formula C19H19BrF4N2O3 and a molecular weight of 479.27 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-(5-bromo-2-fluoro-3-pyridinyl)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-(5-bromo-2-fluoro-3-pyridinyl)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 86673420 |
| Molecular Formula | C19H19BrF4N2O3 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-(5-bromo-2-fluoro-3-pyridinyl)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1cc(Br)cnc1F)[C@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19BrF4N2O3/c1-18(2,3)29-17(28)26-14(13-8-12(20)9-25-16(13)21)15(27)10-4-6-11(7-5-10)19(22,23)24/h4-9,14-15,27H,1-3H3,(H,26,28)/t14-,15-/m1/s1 |
| InChIKey | MVDSGTNIWVULBH-HUUCEWRRSA-N |
| XLogP | 5.30 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|