C7H11NO6P+ — CID 86674855
[(Z)-3-carboxy-3-(methoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium (PubChem CID 86674855) has the molecular formula C7H11NO6P+ and a molecular weight of 236.14 g/mol. Its IUPAC name is [(Z)-3-carboxy-3-(methoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium.
| Compound Name | [(Z)-3-carboxy-3-(methoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium |
|---|---|
| PubChem CID | 86674855 |
| Molecular Formula | C7H11NO6P+ |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [(Z)-3-carboxy-3-(methoxycarbonylamino)prop-2-enyl]-(hydroxymethyl)-oxophosphanium |
| SMILES | COC(=O)N/C(=C\C[P+](=O)CO)C(=O)O |
| InChI | InChI=1S/C7H10NO6P/c1-14-7(12)8-5(6(10)11)2-3-15(13)4-9/h2,9H,3-4H2,1H3,(H-,8,10,11,12)/p+1/b5-2- |
| InChIKey | AVXRCDJZBPWSJZ-DJWKRKHSSA-O |
| XLogP | 0.09 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|