C23H33N3O2Si — CID 86679151
6-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 86679151) has the molecular formula C23H33N3O2Si and a molecular weight of 411.62 g/mol. Its IUPAC name is 6-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 86679151 |
| Molecular Formula | C23H33N3O2Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 6-[5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(-c3cncc(NCCO[Si](C)(C)C(C)(C)C)c3)ccc21 |
| InChI | InChI=1S/C23H33N3O2Si/c1-23(2,3)29(5,6)28-12-11-25-20-14-19(15-24-16-20)17-7-9-21-18(13-17)8-10-22(27)26(21)4/h7,9,13-16,25H,8,10-12H2,1-6H3 |
| InChIKey | PMHCKCLWDPBNNV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|