C20H23N3O3 — CID 89439796
N-(2-ethoxyethyl)-5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)pyridine-3-carboxamide (PubChem CID 89439796) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89439796 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-(2-ethoxyethyl)-5-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)pyridine-3-carboxamide |
| SMILES | CCOCCNC(=O)c1cncc(-c2ccc3c(c2)CCC(=O)N3C)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-3-26-9-8-22-20(25)17-11-16(12-21-13-17)14-4-6-18-15(10-14)5-7-19(24)23(18)2/h4,6,10-13H,3,5,7-9H2,1-2H3,(H,22,25) |
| InChIKey | DJQDWJAFJITZRC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|