C40H42O8P2 — CID 86682691
dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-4-cyclohexylphenyl] phosphate (PubChem CID 86682691) has the molecular formula C40H42O8P2 and a molecular weight of 712.72 g/mol. Its IUPAC name is dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-4-cyclohexylphenyl] phosphate.
| Compound Name | dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-4-cyclohexylphenyl] phosphate |
|---|---|
| PubChem CID | 86682691 |
| Molecular Formula | C40H42O8P2 |
| Molecular Weight | 712.72 g/mol |
| Exact Mass | 712.24 |
| IUPAC Name | dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-4-cyclohexylphenyl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)Oc1ccc(C2CCCCC2)c(OP(=O)(OCc2ccccc2)OCc2ccccc2)c1 |
| InChI | InChI=1S/C40H42O8P2/c41-49(43-29-33-16-6-1-7-17-33,44-30-34-18-8-2-9-19-34)47-38-26-27-39(37-24-14-5-15-25-37)40(28-38)48-50(42,45-31-35-20-10-3-11-21-35)46-32-36-22-12-4-13-23-36/h1-4,6-13,16-23,26-28,37H,5,14-15,24-25,29-32H2 |
| InChIKey | MWCJVMQMOLQDNS-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.72 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|