About 1-quinolin-6-ylethenyl trifluoromethanesulfonate
1-quinolin-6-ylethenyl trifluoromethanesulfonate (PubChem CID 86683105) has the molecular formula C12H8F3NO3S
and a molecular weight of 303.26 g/mol. Its IUPAC name is 1-quinolin-6-ylethenyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-quinolin-6-ylethenyl trifluoromethanesulfonate |
| PubChem CID | 86683105 |
| Molecular Formula | C12H8F3NO3S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1-quinolin-6-ylethenyl trifluoromethanesulfonate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C12H8F3NO3S/c1-8(19-20(17,18)12(13,14)15)9-4-5-11-10(7-9)3-2-6-16-11/h2-7H,1H2 |
| InChIKey | MVHUJLXQICXPMA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-quinolin-6-ylethenyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-quinolin-6-ylethenyl trifluoromethanesulfonate?
The IUPAC name of 1-quinolin-6-ylethenyl trifluoromethanesulfonate (CID 86683105) is 1-quinolin-6-ylethenyl trifluoromethanesulfonate.
What is the SMILES notation for 1-quinolin-6-ylethenyl trifluoromethanesulfonate?
The canonical SMILES for 1-quinolin-6-ylethenyl trifluoromethanesulfonate is C=C(OS(=O)(=O)C(F)(F)F)c1ccc2ncccc2c1.
What is the InChIKey of 1-quinolin-6-ylethenyl trifluoromethanesulfonate?
The InChIKey is MVHUJLXQICXPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO3S/c1-8(19-20(17,18)12(13,14)15)9-4-5-11-10(7-9)3-2-6-16-11/h2-7H,1H2.
What are the key properties of 1-quinolin-6-ylethenyl trifluoromethanesulfonate?
1-quinolin-6-ylethenyl trifluoromethanesulfonate has a molecular weight of 303.26 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-quinolin-6-ylethenyl trifluoromethanesulfonate is sourced from PubChem (CID 86683105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).