C20H27BF3N5O3 — CID 86684000
1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[[5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]pyridin-2-one (PubChem CID 86684000) has the molecular formula C20H27BF3N5O3 and a molecular weight of 453.27 g/mol. Its IUPAC name is 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[[5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]pyridin-2-one.
| Compound Name | 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[[5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]pyridin-2-one |
|---|---|
| PubChem CID | 86684000 |
| Molecular Formula | C20H27BF3N5O3 |
| Molecular Weight | 453.27 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[[5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]amino]pyridin-2-one |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)cc(Nc2cc3n(n2)CCN(CC(F)(F)F)C3)c1=O |
| InChI | InChI=1S/C20H27BF3N5O3/c1-18(2)19(3,4)32-21(31-18)13-8-15(17(30)27(5)10-13)25-16-9-14-11-28(12-20(22,23)24)6-7-29(14)26-16/h8-10H,6-7,11-12H2,1-5H3,(H,25,26) |
| InChIKey | KRFSTOGCEVTPOR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|