C47H45FO7S — CID 86685161
(2S,3S,4S,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde (PubChem CID 86685161) has the molecular formula C47H45FO7S and a molecular weight of 772.94 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde.
| Compound Name | (2S,3S,4S,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 86685161 |
| Molecular Formula | C47H45FO7S |
| Molecular Weight | 772.94 g/mol |
| Exact Mass | 772.29 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxane-2-carbaldehyde |
| SMILES | CO[C@@]1(c2ccc(C)c(Cc3ccc(-c4ccc(F)cc4)s3)c2)O[C@@](C=O)(CO)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H45FO7S/c1-33-18-21-39(26-38(33)27-41-24-25-42(56-41)37-19-22-40(48)23-20-37)47(51-2)45(54-30-36-16-10-5-11-17-36)43(52-28-34-12-6-3-7-13-34)44(46(31-49,32-50)55-47)53-29-35-14-8-4-9-15-35/h3-26,31,43-45,50H,27-30,32H2,1-2H3/t43-,44-,45+,46-,47-/m0/s1 |
| InChIKey | ITXGNTITKWUFFR-UFPLGCMVSA-N |
| XLogP | 8.97 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.94 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|