C12H11ClN4O4S — CID 86689711
methyl 6-chloro-4-[(5-methylsulfonyl-2-pyridinyl)amino]pyridazine-3-carboxylate (PubChem CID 86689711) has the molecular formula C12H11ClN4O4S and a molecular weight of 342.76 g/mol. Its IUPAC name is methyl 6-chloro-4-[(5-methylsulfonyl-2-pyridinyl)amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-chloro-4-[(5-methylsulfonyl-2-pyridinyl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 86689711 |
| Molecular Formula | C12H11ClN4O4S |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | methyl 6-chloro-4-[(5-methylsulfonyl-2-pyridinyl)amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1nnc(Cl)cc1Nc1ccc(S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C12H11ClN4O4S/c1-21-12(18)11-8(5-9(13)16-17-11)15-10-4-3-7(6-14-10)22(2,19)20/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | PRXZKCUGJMKYHB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |