C23H24Cl2N2O3 — CID 86697407
tert-butyl 6-[C-(3,4-dichlorophenyl)-N-phenoxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 86697407) has the molecular formula C23H24Cl2N2O3 and a molecular weight of 447.36 g/mol. Its IUPAC name is tert-butyl 6-[C-(3,4-dichlorophenyl)-N-phenoxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl 6-[C-(3,4-dichlorophenyl)-N-phenoxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 86697407 |
| Molecular Formula | C23H24Cl2N2O3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | tert-butyl 6-[C-(3,4-dichlorophenyl)-N-phenoxycarbonimidoyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C(C1)C2C(=NOc1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2N2O3/c1-23(2,3)29-22(28)27-12-16-17(13-27)20(16)21(14-9-10-18(24)19(25)11-14)26-30-15-7-5-4-6-8-15/h4-11,16-17,20H,12-13H2,1-3H3 |
| InChIKey | VLGOOLJRZRBDNI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|