C23H30N2O4 — CID 86697979
benzyl N-[4-(3-hydroxy-1-methylpiperidin-4-yl)-2-propan-2-yloxyphenyl]carbamate (PubChem CID 86697979) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is benzyl N-[4-(3-hydroxy-1-methylpiperidin-4-yl)-2-propan-2-yloxyphenyl]carbamate.
| Compound Name | benzyl N-[4-(3-hydroxy-1-methylpiperidin-4-yl)-2-propan-2-yloxyphenyl]carbamate |
|---|---|
| PubChem CID | 86697979 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | benzyl N-[4-(3-hydroxy-1-methylpiperidin-4-yl)-2-propan-2-yloxyphenyl]carbamate |
| SMILES | CC(C)Oc1cc(C2CCN(C)CC2O)ccc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O4/c1-16(2)29-22-13-18(19-11-12-25(3)14-21(19)26)9-10-20(22)24-23(27)28-15-17-7-5-4-6-8-17/h4-10,13,16,19,21,26H,11-12,14-15H2,1-3H3,(H,24,27) |
| InChIKey | PTKPZXDSBWIDIW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |