C25H29ClO5 — CID 86700976
ethyl 2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate (PubChem CID 86700976) has the molecular formula C25H29ClO5 and a molecular weight of 444.96 g/mol. Its IUPAC name is ethyl 2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate.
| Compound Name | ethyl 2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 86700976 |
| Molecular Formula | C25H29ClO5 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | ethyl 2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CCc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H29ClO5/c1-4-28-22(27)15-20-21(29-24-23(20)30-25(2,3)31-24)14-7-16-5-8-17(9-6-16)18-10-12-19(26)13-11-18/h5-6,8-13,20-21,23-24H,4,7,14-15H2,1-3H3/t20-,21-,23-,24-/m1/s1 |
| InChIKey | VXZBESALPMSUDM-LUGTWXOSSA-N |
| XLogP | 5.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |