C30H44ClNO6S — CID 160801102
2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl methanesulfonate;N,N-diethylethanamine (PubChem CID 160801102) has the molecular formula C30H44ClNO6S and a molecular weight of 582.20 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl methanesulfonate;N,N-diethylethanamine.
| Compound Name | 2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl methanesulfonate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 160801102 |
| Molecular Formula | C30H44ClNO6S |
| Molecular Weight | 582.20 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 2-[(3aR,5R,6R,6aR)-5-[2-[4-(4-chlorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl methanesulfonate;N,N-diethylethanamine |
| SMILES | CC1(C)O[C@H]2O[C@H](CCc3ccc(-c4ccc(Cl)cc4)cc3)[C@@H](CCOS(C)(=O)=O)[C@H]2O1.CCN(CC)CC |
| InChI | InChI=1S/C24H29ClO6S.C6H15N/c1-24(2)30-22-20(14-15-28-32(3,26)27)21(29-23(22)31-24)13-6-16-4-7-17(8-5-16)18-9-11-19(25)12-10-18;1-4-7(5-2)6-3/h4-5,7-12,20-23H,6,13-15H2,1-3H3;4-6H2,1-3H3/t20-,21-,22-,23-;/m1./s1 |
| InChIKey | SDBSBRUXAPCLTQ-VPPXICKUSA-N |
| XLogP | 6.15 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.20 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|