C31H29F2NO5 — CID 67182644
2-[2-[(3aS,5R,6S,6aS)-5-[2-[4-(3,5-difluorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione (PubChem CID 67182644) has the molecular formula C31H29F2NO5 and a molecular weight of 533.57 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6S,6aS)-5-[2-[4-(3,5-difluorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(3aS,5R,6S,6aS)-5-[2-[4-(3,5-difluorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67182644 |
| Molecular Formula | C31H29F2NO5 |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 2-[2-[(3aS,5R,6S,6aS)-5-[2-[4-(3,5-difluorophenyl)phenyl]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC1(C)O[C@@H]2O[C@H](CCc3ccc(-c4cc(F)cc(F)c4)cc3)[C@H](CCN3C(=O)c4ccccc4C3=O)[C@@H]2O1 |
| InChI | InChI=1S/C31H29F2NO5/c1-31(2)38-27-25(13-14-34-28(35)23-5-3-4-6-24(23)29(34)36)26(37-30(27)39-31)12-9-18-7-10-19(11-8-18)20-15-21(32)17-22(33)16-20/h3-8,10-11,15-17,25-27,30H,9,12-14H2,1-2H3/t25-,26+,27-,30-/m0/s1 |
| InChIKey | VZFOIDIUNRXAKL-OWWCKCFISA-N |
| XLogP | 5.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|