C28H29ClN2O10 — CID 160823187
2-[2-[(2R,3R,4S,5R)-4,5-dihydroxy-2-[2-[4-(6-methoxy-3-pyridinyl)phenyl]ethyl]oxolan-3-yl]ethyl]isoindole-1,3-dione;perchloric acid (PubChem CID 160823187) has the molecular formula C28H29ClN2O10 and a molecular weight of 589.00 g/mol. Its IUPAC name is 2-[2-[(2R,3R,4S,5R)-4,5-dihydroxy-2-[2-[4-(6-methoxy-3-pyridinyl)phenyl]ethyl]oxolan-3-yl]ethyl]isoindole-1,3-dione;perchloric acid.
| Compound Name | 2-[2-[(2R,3R,4S,5R)-4,5-dihydroxy-2-[2-[4-(6-methoxy-3-pyridinyl)phenyl]ethyl]oxolan-3-yl]ethyl]isoindole-1,3-dione;perchloric acid |
|---|---|
| PubChem CID | 160823187 |
| Molecular Formula | C28H29ClN2O10 |
| Molecular Weight | 589.00 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | 2-[2-[(2R,3R,4S,5R)-4,5-dihydroxy-2-[2-[4-(6-methoxy-3-pyridinyl)phenyl]ethyl]oxolan-3-yl]ethyl]isoindole-1,3-dione;perchloric acid |
| SMILES | COc1ccc(-c2ccc(CC[C@H]3O[C@@H](O)[C@@H](O)[C@H]3CCN3C(=O)c4ccccc4C3=O)cc2)cn1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C28H28N2O6.ClHO4/c1-35-24-13-11-19(16-29-24)18-9-6-17(7-10-18)8-12-23-22(25(31)28(34)36-23)14-15-30-26(32)20-4-2-3-5-21(20)27(30)33;2-1(3,4)5/h2-7,9-11,13,16,22-23,25,28,31,34H,8,12,14-15H2,1H3;(H,2,3,4,5)/t22-,23+,25-,28+;/m0./s1 |
| InChIKey | SFUUSARBPPDNCT-AEFFIDPESA-N |
| XLogP | -1.05 |
| TPSA | 198.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.00 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|