C15H28N4O5 — CID 86701026
tert-butyl 3-[(2-hydrazinyl-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]azetidine-1-carboxylate (PubChem CID 86701026) has the molecular formula C15H28N4O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl 3-[(2-hydrazinyl-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-hydrazinyl-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 86701026 |
| Molecular Formula | C15H28N4O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | tert-butyl 3-[(2-hydrazinyl-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N(CC(=O)NN)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28N4O5/c1-14(2,3)23-12(21)18-7-10(8-18)19(9-11(20)17-16)13(22)24-15(4,5)6/h10H,7-9,16H2,1-6H3,(H,17,20) |
| InChIKey | XPXPWPWQIQHXSW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|