C15H25N3O3 — CID 170565878
tert-butyl 3-[3-(2-hydrazinyl-2-oxoethyl)-1-bicyclo[1.1.1]pentanyl]azetidine-1-carboxylate (PubChem CID 170565878) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 3-[3-(2-hydrazinyl-2-oxoethyl)-1-bicyclo[1.1.1]pentanyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(2-hydrazinyl-2-oxoethyl)-1-bicyclo[1.1.1]pentanyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 170565878 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl 3-[3-(2-hydrazinyl-2-oxoethyl)-1-bicyclo[1.1.1]pentanyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C23CC(CC(=O)NN)(C2)C3)C1 |
| InChI | InChI=1S/C15H25N3O3/c1-13(2,3)21-12(20)18-5-10(6-18)15-7-14(8-15,9-15)4-11(19)17-16/h10H,4-9,16H2,1-3H3,(H,17,19) |
| InChIKey | RGBVDELEOIEEQN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|