C14H17ClN6O2 — CID 86701912
5-amino-3-(3-chloro-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide (PubChem CID 86701912) has the molecular formula C14H17ClN6O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is 5-amino-3-(3-chloro-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-(3-chloro-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86701912 |
| Molecular Formula | C14H17ClN6O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-amino-3-(3-chloro-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(Nc2ccc(N3CCOCC3)c(Cl)c2)n[nH]c1N |
| InChI | InChI=1S/C14H17ClN6O2/c15-9-7-8(1-2-10(9)21-3-5-23-6-4-21)18-14-11(13(17)22)12(16)19-20-14/h1-2,7H,3-6H2,(H2,17,22)(H4,16,18,19,20) |
| InChIKey | IBMDVAHUUVETRB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|