C20H12F3N3O — CID 86703036
4-[6-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidin-7-yl]benzaldehyde (PubChem CID 86703036) has the molecular formula C20H12F3N3O and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-[6-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidin-7-yl]benzaldehyde.
| Compound Name | 4-[6-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidin-7-yl]benzaldehyde |
|---|---|
| PubChem CID | 86703036 |
| Molecular Formula | C20H12F3N3O |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[6-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyrimidin-7-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2nc3nc(C(F)(F)F)cn3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H12F3N3O/c21-20(22,23)17-11-26-10-16(14-4-2-1-3-5-14)18(25-19(26)24-17)15-8-6-13(12-27)7-9-15/h1-12H |
| InChIKey | AVJWVUCFQSPGGV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|