C20H13N3O3 — CID 87616611
7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylic acid (PubChem CID 87616611) has the molecular formula C20H13N3O3 and a molecular weight of 343.34 g/mol. Its IUPAC name is 7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylic acid.
| Compound Name | 7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87616611 |
| Molecular Formula | C20H13N3O3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylic acid |
| SMILES | O=Cc1ccc(-c2nc3nc(C(=O)O)cn3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H13N3O3/c24-12-13-6-8-15(9-7-13)18-16(14-4-2-1-3-5-14)10-23-11-17(19(25)26)21-20(23)22-18/h1-12H,(H,25,26) |
| InChIKey | IODRPBKUOFJGGQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|